Draw the structure of the following phospholipid: a cephalin formed from two molecules of stearic acid.

Q: After a substance acting as a strong base reacts, what remains of the base? Select one: a. a weaker…

A:

Q: element scandium chlorine sulfur lithium symbol of ion 3+ Sc 0 0 beryllium 0 most likely ion type of…

A: The question is asked to determine the type of the ions formed from each of the given elements.To…

Q: A neutral object is sketched below, in black and white. There are positive and negative electric…

A: Opposite charges tends to attract each other.Positive charge attracts negative charge towards it,…

Q: Identify the class of lipid of the following molecule: O || CH3-(CH2)18-C-O-(CH2)19-CH3 steroid…

A:

Q: Consider the following galvanic cells. Diagram I Au- 1.0 M Au chemPad Xu X® - = + 60 1.16 --Pt 1.0 M…

A: Given are the two cells Cell 1Cell 2

Q: A gaseous mixture contains 422.0 Torr H2(g), 363.7 Torr N2(g), and 89.1 Torr Ar(g). Calculate the…

A: The mole fraction of a component in the mixture is defined as the ratio of moles of that substance…

Q: Which of the following pairs of carbohydrates contains two polysaccharides? Select one: a. amylose…

A:

Q: What is the IUPAC name of the following compound?

A: For naming of an organic molecule,Take the highest carbon containing carbon chain as parent or base…

Q: What is the name of the process by which a solute dissolves in a solvent? OA. Precipitation O B.…

A: A solute is a substance that is dissolved in a solvent (the medium) to form a solution.

Q: Which of the following pairs of Starting Materials result in the given Robinson Annulation product?…

A: Robinson annulation is a Michaeld addition followed by aldol condensation

Q: The metal rhenium becomes superconducting at temperatures below 1.4 K. Calculate the temperature at…

A:

Q: Order the following four aqueous solutions by their freezing point temperature. The concentrations…

A:

Q: What is the difference between a coordination complex and a ligand? A ligand is a type of molecule…

A: In the given question we have to find out the difference between coordination complex and a ligand.…

Q: Which one of the following complexes CAN exhibit geometrical isomerism? Check all that apply. A.…

A: The coordination compounds that have the same molecular formula but have their ligands attached to…

Q: What is the product of the following chemical reaction? A) OH O Compound E O Compound C O Compound B…

A: Controlled reduction of an ester with DIBALH gives aldehyde

Q: What is the major organic product for the following reaction?

A: When the benzene reacts with an alkyl halide in the presence of a Lewis acid catalyst alkyl benzene…

Q: (a) Provide a curved arrow mechanism for the reaction shown below, commenting on the stereochemical…

A: The above question is  based on organic reaction and mechanism and we have to discuss the mechanism…

Q: OTMS OTS Ts the reaction between 1-butano

A: Given1-Butanol TMSCl - Trimethyl silyl ChlorideEt3NSilicon atom has vacant d-orbitals. It accepts…

Q: What is the structure of the compound whose mass spectrum is depicted below? Relative Intensity 100…

A: Given Mass Spectrum:Given compound

Q: Write balanced half-reactions for the following redox reaction: 12 Cu( reduction: oxidation:…

A: Oxidation:Loss of electrons or increase in magnitude of potive oxidation state or decrease in the…

Q: highest freezing point (highest temperature) 0.015 m calcium chloride, CaCl₂ 1 2 3 4 0.010 m sodium…

A: The temperature at which a liquid solidifies (freezes). Increased pressure, like increased…

Q: 1. Ethene can react with steam to produce ethanol. (a) Write an equation for the reaction above. (b)…

A: For the reaction of ethene with steam to produce ethanol, we have to answer:a) Equation of the…

Q: The mass of a proton is 1.00728 amu and that of a neutron is 1.00867 amu. What is the binding energy…

A:

Q: the region of the infrared spectrum in which their absorptions occur. Place the letter of the region…

A: Infrared radiation refers to a type of electromagnetic radiation with wavelengths longer than those…

Q: Compare the C-C bond orders for bromobenzene and phenyl magnesium bromide. What impact does the…

A: The C-C bond order represents the number of electron pairs shared between two carbon atoms.In…

Q: Which of the following is expected to be a major product of the reaction sequence shown in the box?…

A: Sodium borohydride (NaBH4 ) is a convenient source of hydride ion (H-) for the reduction of…

Q: What volumes of H2₂(9) and O₂(g) at STP are produced from the electrolysis of water by a current of…

A: Given process: electrolysis of watercurrent = I = 2.64 ATime = t = 15.5 minCondition : STPVolume of…

Q: (a) (i) Ksp value of Cul is 5.0 x10-12 mol-dm at 25 °C. Calculate the maximum number of moles of Cul…

A:

Q: 4. What is the pH of a buffer made from 0.42 M H3BO3 and 0.22 M H2BO3-, if the Ka for H3BO3 is 7.3 x…

A:

Q: What is the correct name of the following amino acid?

A: Amino acids are biomolecules that have both amine (-NH2) and carboxylic acid (-COOH) in same…

Q: Predict the dominant form of the amino acid shown below at pH 10.0. Given: pKa a-carboxyl 2.2, pka…

A: Amino acids are amphoteric biomolecules that have both the acidic carboxylic acid COOH group and…

Q: Unknown 2.5 12 13 1.4 15 24 26. 26 27 36 Fot abund. 0.2 0.4 0.4 1.0 0.4 0,8 3.2 2:6 0.9 28 13. 0:4…

A: Mass spectra is a technique used in laboratory to identify the molecular formula of the compound…

Q: Predict the products when triacontyl hexadecanoate, a major component of beeswax is treated with…

A: When an ester is hydrolyzed, an alcohol and a carboxylic acid are formed.

Q: Sodium carbonate can be made by heating sodium bicarbonate: 2NaHCO3(s) → Na2CO3(s) + CO₂(g) + H₂O(g)…

A:

Q: 1) Which of the following compounds is stable under aqueous basic reaction conditions? Record your…

A: We have to identify the most stable compound under aqueous basic solution.

Q: O: NaOH ? Which SM Combination

A:

Q: Use the bond energies provided to estimate ΔH°rxn for the reaction below. XeF2 + 2 F2 → XeF6 ΔH°rxn…

A: Given Data:Bond energy of Xe-F =140 kJ/molBond energy of F-F = 153 kJ/molTo determine: ΔH°rxn for…

Q: Determine the grams of sodium chloride produced when 10.0g of sodium reacts with 10.0g of chlorine…

A: Mass of sodium = 10.0 gm Mass of Chlorine gas = 10.0 gm  Also molar mass of sodium = 23 g/mol Molar…

Q: Multiply or divide the following measurements. Be sure each answer you enter contains the correct…

A: The final result of multiplication and division should be rounded to the same number as the least…

Q: 1) For each compound, complete the following steps: a) Write a complete, balanced combustion…

A: Bond energy is the energy required to break 1 mol of bond of a particular type. The enthalpy of the…

Q: An automobile engine generates 2200 Joules of heat that must be carried away by the cooling system.…

A: According to the first law of thermodynamics, where '' is the change in internal energy, 'q' is the…

Q: NH NBr ? NH

A: This is an example of electrophilic aromatic substitution reaction

Q: Consider the following half-reactions Cu+eCu E-+0.521 V H₂O₂ +2e H₂O E = +1.776 V Question 2 Which…

A:

Q: Use your integrated rate equation to calculate the amount of time that would be required to have…

A: Chemical kinetics is a discipline of physical chemistry concerned with the speeds of chemical…

Q: To answer the questions, interpret the following Lewis diagram for NO2Cl. For the central nitrogen…

A: Lewis digram is a diagrammatic representation of molecules in which bonding and non-bonding…

Q: -11 An aqueous solution at 25 °C has a OH concentration of 1.9 × 10 M. Calculate the H₂O…

A: pH of solution is defined as negative logarithm of hydogen ions present in the solution.At 25°…

Q: Consider the following reaction.  From the given choices of intermediates and/or final products,…

A: Esters are hydrolyzed into carboxylic acid and alcohol in the presence of an acid or base catalyst.…

Q: Step 1 Step 2 Step 3 CO(g) + 2H₂(g) → CH3OH(g), AH = ? 2CO(g) + O₂(g) → 2CO2(g) 2H₂(8) + O₂(8)→→…

A: Hess's LawFor a chemical equation that can be written as the sum of two or more steps, the enthalpy…

Q: What is the IUPAC name of the following compound? CH3 0 || CH₂CHCH₂CCH3

A: The naming of the organic compound is done using the IUPAC system. IUPAC system of nomenclature is…

Q: Pls help ASAP on both questions I HUMBLY REQUEST

A:

Types of Polymers on the basis of Method of Preparation