When compound CH3-C(CH3)=CH-CH2-CH(CH3)2 is the SUBSTRATE (reactant) in a HALOGENATION reaction with Br2 (and CH2Cl2 as the solvent), a correct condensed structural formula for the MAJOR SUBSTRATE PRODUCT of this reaction is:
Q: 10 ml of a 0.02M stock solution of potassium permanganate was diluted in 100 ml of water. Using this…
A: Initial volume(V1) = 10 mL Initial concentration(M1) = 0.02 M After dilution, Volume (V2) = 100 mL…
Q: 96. For the reaction of hydrazine (N₂H4) in water, H₂NNH₂(aq) + H₂O(1) —H₂NNH; (aq) + OH(aq) K is…
A:
Q: Classify the reaction below. H₂C oxidation reduction dehydration hydration hydrolysis OH H3C H
A:
Q: Consider the complete combustion of octane. Calculate the bond energies (in kJ/mol) for the:…
A:
Q: buffer consists of 0.44 M NH3 and 0.25 M NH4CL (pKb of NH3 = 4.74). Calculate the pH after the…
A: Molarity is defined as number of mole of substance divide by volume of solution in liter
Q: detail mechanism of koenigs-knorr reaction. ans must be handwritten
A: Koenigs–Knorr reaction in organic chemistry is the substitution reaction of a glycosyl halide with…
Q: a. Identify the fractions of crude oil and their respective boiling temperature ranges. b. Which…
A: We need to identify the fractions of crude oil and their respective boiling temperature ranges and…
Q: The pH of a basic solution is 11.27. What is [H*]?
A: pH = 11.27 [H+] = ?
Q: Consider the complete combustion of octane. Calculate the bond energies (in kJ/mol) for the:…
A: Since, The standard enthalpy of the formation is defined as change of enthalpy of 1 mol of the…
Q: Which is the most acidic hydrogen in the following compound?
A: Activated methylene group: The methylene group present between two electron-withdrawing groups known…
Q: Enter your answer in the provided box. How many milliliters of a 4.35 M H₂SO4 solution are needed to…
A:
Q: What are the boiling point and freezing point of a 1.47 m solution of naphthalene in benzene? Note:…
A: Here, we have to find the boiling and freezing point of a solution of 1.47 m solution of naphthalene…
Q: There are unpaired electrons in a ground state phosphorus atom.
A:
Q: 15) What are everyday applications for dissolving processes that are exothermic? Give two. Your…
A: An exothermic reaction is a chemical reaction in which energy is released to the surroundings in the…
Q: Substance Quantity Initial temperature Final temperature Water 466 grams 8.50°C 74.60°C 1. Based on…
A:
Q: In the laboratory, a general chemistry student measured the pH of a 0.509 M aqueous solution of…
A: In the multiple questions, we solve only first question according to the Bartleby guidelines. If you…
Q: Calculate the percent purity of oxalic acid in a commercial product if a 0.7984-g sample of it…
A: The balanced chemical equation for the reaction between oxalic acid (H2C2O4) and sodium hydroxide…
Q: 2.4 mol Cu
A: Note : 1 mol of any element= 6.02 ×10^(23) atoms. Part (a) 2.4 mol Cu So, 2.4 mol Cu =…
Q: Steam reforming of methane (CH4) produces "synthesis gas," a mixture of carbon monoxide gas and…
A:
Q: How many transition states are involved in the following reaction?
A: The question is based on the concept of organic reactions. we need to identify the transition States…
Q: A volume of 500 mL of -170 M NaOH is added to 605mL of. 250 M weak acid (ka = 2.37x10-5). What is…
A: Given - volume of HA = 605 mL volume of Naoh = 500 mL Molarity of Naoh = 0.170 M Molarity of HA…
Q: Calculate the de Broglie wavelength (in nm) of a 0.370 kg tennis ball moving with a speed of 45.0…
A: We have to calculate the de Broglie wavelength (in nm)
Q: Refer to the diagram to answer the questions below: At standard temperature and pressure, bromine…
A: Answer: Phase diagram is the representation of different physical states of a matter at different…
Q: Balance the following chemical equations: A. CaCO3 + HCI B. H₂S + Fe(OH)3 CaCl2 + CO2 + H₂O Fe2S3 +…
A:
Q: Useful Information: sodium metam:…
A: 1. To determine how long it takes for the maximum contaminant concentration to reach Lake Shasta, we…
Q: 39. 4.00 grams of sodium hydroxide is dissolved in enough water to make a volume of 4.00 liters of…
A: Molarity is defined as number of mole of substance divide by volume of solution in liter
Q: XII. What outershell configuration did the single bonded nitrogen use in forming this compound? a)…
A: In the given question we have to write the outer shell electronic configuration of singly bonded…
Q: Enter your answer in the provided box. From the following heats of combustion, 3 CH₂OH() + O₂(g) →…
A: Given that, We have to calculate the enthalpy of formation of methanol from the given data.
Q: Write the name of the conjugate acid N,N-deithyl-1-pentanamine?
A: According to Bronsted Lowry concept acids are Hydrogen ion or proton donors while bases are Hydrogen…
Q: The conjugate base of HSO3 is A) HSO3²- B) SO3²- C) HSO₂™ D) H₂SO3 T
A: Conjugate acid and conjugate base Conjugated acid base pair Can be define as the acid base pair…
Q: A flask with pressure 2000 mmHg contains 6 mol of helium with a partial pressure of 1437 mmHg. If…
A: According to Dalton's law of partial pressure , Total pressure of mixture of gases is equal to the…
Q: Question 34 A person drinks 1.50 kg of water (H2O) per day. How many moles is this? (Show your…
A: This question belong to some basic concept of Chemistry that is Mole Concept. We know that, 18 g of…
Q: Calculate the final temperature of 100.0 mL of water (d=1.00 g/mL) at 19.0°C [p = 75.3 J/mol.°C)]…
A:
Q: When the following compound is dissolved in water containing a trace of acid, two products can be…
A:
Q: Calculate the change in entropy when 25 kJ of energy is transferred reversibly and isothermally as…
A: They are described below.
Q: 10. When pH changes the charge from neutral to positive or negative, how does this effect the…
A: In the given question, we have to find the affect on solubility after change in charge due to pH.
Q: Determine the pl for this synthesized pentapeptide: A-B-C-D-E Given that the pK values for the amino…
A:
Q: For each of the following pairs, which molecule would you expect to react faster with a nucleophile?…
A: For the reaction with nucleophile, we know that nucleophiles are electron rich species i.e. they…
Q: Will 3-methylhexanoic acid be positive or neutral with an pH of 6.38?
A: To determine if 3-methylhexanoic acid will be positive or neutral at a pH of 6.38, we need to…
Q: When 235 mg of an unknown electrolyte with the general form AX2 is dissolved in 0.846 L of ethanol…
A:
Q: Why beta plus spectrum starts at 0 but beta minus spectrum doesn’t??What is the basic difference…
A: The reason why the beta-plus spectrum starts at 0 energy is because a positron (β+) is an…
Q: How many hydrogen atoms are there in 2.50 moles of C6H12O6
A:
Q: What were the differences between solvents that dissolved aspirin the best/worst? Explain with…
A: Aspirin is a polar molecule containing COOH and -OCOCH3 groups. Therefore, polar solvents with…
Q: l Tues Write a skeleton equation for the reaction between lithium(s) and chlorine gas to produce…
A:
Q: Draw the Lewis dot structure of the conjugate base of cyclopentane by assuming all the atoms in the…
A: Lewis’s structure: Lewis’s bonding theory is based on the octet rule. The Lewis structure is a…
Q: What concentration would a 100X stock of atrazine be if you will use it at 3 ppb?
A: 3 ppb atrazine represents 3 μg/L solution. The molar mass of atrazine is 215.68 g/mol. To determine:…
Q: The reaction for photosynthesis, which occurs in plants, is used to convert carbon dioxide and water…
A:
Q: Which of the following is a conjugate acid- base pair? A) H2O, NHa* B) NH3, OH- C) NH3, NH4* D)…
A:
Q: What is the molarity of ions in a 0.824 M solution of Li₂SO4 assuming the compound dissociates…
A: Given, Molarity of Li2SO4 solution = [Li2SO4] = 0.824 M Molarity of ions (Li+ and SO42-), Molarity…
Q: Oxalic acid, H₂C₂O4, reacts with sodium hydroxide in a neutralization reaction. What is the balanced…
A: Since, Balanced reaction means that both side number of atom present in equal number. Thus, For…
When compound CH3-C(CH3)=CH-CH2-CH(CH3)2 is the SUBSTRATE (reactant) in a HALOGENATION reaction with Br2 (and CH2Cl2 as the solvent), a correct condensed structural formula for the MAJOR SUBSTRATE PRODUCT of this reaction is:
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- Write the structural formulas for two (2) chloro-isomers that can formed from 2-methypropane (isobutene). How many sets of equivalent hydrogen are there in the compound 2-methypropane?Compounds X and Y both have the formula C7H14. Both X and Y react with one molar equivalent of hydrogen in the presence of a palladium catalyst to form 2-methylhexane. The heat of hydrogenation of X is greater than that of Y. Both X and Y react with HCI to give the same single C₂H₁5Cl compound as the major product. What is the structure of X? • In cases where there is more than one answer, just draw one. 7 0▾ ChemDoodleⓇ 146Compounds Y and Z both have the formula C₂H18. Both Y and Z react with one molar equivalent of hydrogen in the presence of a palladium catalyst to form 2-methyloctane. The heat of hydrogenation of Y is less than that of Z. Y and Z each undergo hydroboration/oxidation to give a primary alcohol (OH attached to a primary carbon). What is the structure of Y? • In cases where there is more than one answer, just draw one. 1998) 0▾ + n [F ChemDoodle a
- When 5-isopropyl-2,3,4,7-tetramethyloctane undergoes complete combustion in the presence of oxygen gas and heat, which of the following substances is/are formed as product/s? Select one or more: Solid carbon Hydrogen gas Water Carbon dioxide Carbon monoxideExcluding compounds that contain methyl or ethyl groups, write structural formulas for all the bicyclic isomers of (a) C5H8 and (b) C6H10.An unknown hydrocarbon A with the formula C6H12 reacts with 1 molar equivalent of H2 over a palladium catalyst. Hydrocarbon A also reacts with OsO4 to give diol B. When oxidized with KMnO4 in acidic solution, A gives two fragments. One fragment is propanoic acid, CH3CH2CO2H, and the other fragment is ketone C. What are the structures of A, B, and C? Write all reactions, and show your reasoning.
- Compounds X and Y both have the formula C7H₁4. Both X and Y react with one molar equivalent of hydrogen in the presence of a palladium catalyst to form 2-methylhexane. The heat of hydrogenation of X is greater than that of Y. Both X and Y react with HCI to give the same single C7H15Cl compound as the major product. What is the structure of X? • In cases where there is more than one answer, just draw one. 23 ▾ Sn [F ChemDoodleⓇ 146(1) Write a complete chemical equation showing reactants, products, and catalysts needed (if any) for the following reaction and (2) Draw and name the organic compound found in every reaction. (a) Complete hydrogenation of 2-Methylhexa-1,5-diene (b) Complete halogenation (Br2) of 3-Ethyl-2,2-dimethylhept-3-ene (c) Reaction of (4E)-2.4-Dimethylhexa-1,4-diene with a mole of water (d) Reaction of cis-3,3-Dimethyl-4-propylocta-1,5-diene with two mole of HBr (e) Reaction of trans-1-Bromo-3-chlorocyclopentane with potassium hydroxide (f) Formation of Gilman reagent using isopropyl bromide (g) Ozonolysis of 3,3-Dimethyloct-4-yne (h) Complete halogenation (Cl2) of 3-Ethyl-5-methyl-1,6,8-decatriyne (i) Partial hydrogenation using Lindlar's Catalyst 2,2,5,5-Tetramethylhex-3-yne (i) Reaction of 3.4-Dimethylcyclodecyne with sodium amideGive the classification of the following alcohols as to primary, secondary, or tertiary.
- Alkenes can be converted to alcohols by reaction with mercuric acetate to form a β-hydroxyalkylmercury(II) acetate compound, a reaction called oxymercuration. Subsequent reduction with NaBH4 reduces the C–Hg bond to a C–H bond, forming the alkyl alcohol, a reaction called demercuration. Draw the structures of the Hg-containing compound(s) and the final alcohol product(s) formed in the following reaction sequence, omitting byproducts. If applicable, draw hydrogen at a chirality center and indicate stereochemistry via wedge-and-dash bonds.(a) Alkenes are relatively stable compounds but are more reactive than alkanes and serve as a feedstock for the petrochemical industry because they can participate in a wide variety of reactions. Predict the products obtained from following reaction. Write the chemical reaction and name the products according to IUPAC system. (i) the reaction of 3-ethyl-3-methyl-1-pentene with hydrogen bromide (ii) the reaction of 3-ethyl-2-pentene with hydrogen bromideI am confused as to which compound from the following: cyclhexane, ethyne, hept-2-ene, Ch2(CH2)14Ch2OH, dode-1-yne, Ch3Ch2CO2H,Propan-2-ol, Ch3(Ch2)14CO2H; is miscible in water, is an insoluble gas, is a water insosuble solid, is a wter insoluble liquid, is a water insoluble liquid- it burns clean, is a water insuloble liquid-it burns dirty, us water mscible. What do I look for to assign each compound to its coorect characterisitcs.