Q: please answer in text form and in proper format answer with must explanation , calculation for each…
A:
Q: Namethefollowingcompounds.
A: Step 1: Information: As we know that we give the name of compound according to IUPAC nomenclature…
Q: Please don't provide handwritten solution .... What is the major product of the following?
A:
Q: None
A: Given: Ag++NO→Ag+NO3−Step 1: Write the half-reaction.Ag+→AgNO→NO3− Step 2: Balance the atoms…
Q: C. MeO₂C HOC MeO₂C MeO₂C NH2 MeO₂C NH3
A: Step 1: Step 2: Step 3: Step 4:
Q: 9. How many electron pairs are around the central atom of SF4?
A: In SF4, sulfur tetrafluoride, the central sulfur atom has five electron pairs around it, consisting…
Q: HCNO - strong, weak, nonelectrolyte
A: The question is asking us to determine whether HCNO (fulminic acid) is a strong electrolyte, a weak…
Q: If 28.0% of a sample of sodium-24 decays in table(sodium-24) hours, what is the half-life of this…
A: The objective of this question is to calculate the half-life of the sodium-24 isotope given the…
Q: Oxidation/Reduction Practice:
A: Thank you.
Q: None
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: not sure if am doing this right trying to put the reactants and products into synthetic equations…
A: Step 1: Step 2: Step 3: Step 4:
Q: what does the complete SN2 mechanism (with curved arrows) of the reaction of 2-bromobutane with…
A: SN2 reaction is a concerted process, it means that they are one step process. The nucleophile…
Q: please answer in text form and in proper format answer with must explanation , calculation for each…
A: The Fischer esterification reaction involves the reaction between a carboxylic acid and an alcohol…
Q: Determine the value of Kc for the reaction 1 A + 1 B ⟷ 1 C for the following equilibrium…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: 6. True or False: All alcohol dehydrations require the presence of strong acid. (3 pts)
A: Step 1: Alcohol in presence of acid such as H2SO4, concentrated HCl dehydrated to form products (…
Q: Oxidation/Reduction Practice:
A: 2A) The overall ionic equation will be:- Sn2+(aq) + 2Cl-(aq) + Hg2+(aq) +2Cl-…
Q: 10. 10 Consider the following combustion reactions: 2 C2H6(g) +7 O2(g) →4 CO2(g) + 6 H₂O(/)…
A: Step 1: Step 2: Step 3: Step 4:
Q: Unknown Cations: Na+, K+ anion: CO³ 335 Have: Na+, K+, CO Qualitative Analysis & Deductive…
A: Write the ionic reaction for the precipitate formed. The net ionic equation for the reaction…
Q: Complete and balance the following redox reaction in acidic solution CIO¨(aq) + Cl(aq) → Cl2(g) +…
A: Thank you.
Q: Calculate the Gibbs Free Energy of the reaction shown below: 12 NH3(g) + 21 O2(g) → 8…
A:
Q: Calculate the cell potential for: Al/Al+3//Co+3,Co+2/Pt
A: Given: Al(s)∣Al(aq)3+∣∣CO(aq)3+,Co(aq)2+∣Pt(s)Step 1: Write the general form of cell…
Q: Use each of the two methods of buffer preparation to make a 1.0 M buffer with a 1:2 conjugate ratio…
A: The objective of the question is to calculate the amount of conjugate acid needed to prepare a…
Q: 17. Which one of the following substances can be melted without breaking chemical bonds? (a) sodium…
A: Out of all the given choices, only sulfur dioxide can be melted without breaking its chemical bonds.
Q: C…
A: Aldopentose are carbohydrates which contain an aldehyde group with five carbon atoms.There are many…
Q: If 50.0 mL of 1.00 x 10-5 M Fe3+ in a buffer were to be extracted with 5 equal 25.0 mL portions of…
A: The objective of the question is to find the pH of the buffer that would allow for the removal of…
Q: 12 (a) (b) Describe how you can obtain the integrated form of the Clapeyron equation as below. State…
A: The objective of the question is to derive the integrated form of the Clapeyron equation and use it…
Q: Provide the structure of the product(s) of the given reaction. If the reaction cannot occur, check…
A:
Q: Please don't provide handwritten solution ...
A: The objective of the question is to identify the missing reactant 'R' in the given organic reaction…
Q: A certain metal M forms a soluble nitrate salt M (NO3)2. Suppose the left half cell of a galvanic…
A: Step 1:
Q: 18. Which shows the chair conformation of the carbohydrate whose Fischer projection is shown below?…
A: Step 1: Step 2:Step 3: Step 4:
Q: 26 to two decimal places. Type Bur answer. A sodium hydroxide solution that contains 25.5 grams of…
A: Given: Concentration of NaOH solution = 25.5 grams NaOH per liter solutionDensity of solution = 1.06…
Q: .2+ In aqueous solution the Ni ion forms a complex with four cyanide anions. Write the formation…
A: First step of the Balanced chemical equation for the formation of the complex: Ni (H2O)42+…
Q: For the following transformation: Me моя + H Me NaOMe MeOH 1. Draw all four possible products you…
A: Step 1: First, it is known that when sodium methoxide (NaOMe) and methanol (MeOH) react, there may…
Q: How many signals would be in a CNMR AND HNMR for this product? Please explain in depth.
A: Step 1: Step 2: Step 3: Step 4:
Q: Chemistry
A: To calculate the equilibrium molarity of HPO4^2- in a 0.14 M solution of phosphoric acid (H3PO4), we…
Q: If it takes 60 days for 100 mgmg of a particular radioactive isotope to decay to 3.13 mgmg what is…
A: Approach to solving the question:Please see attached photos for detailed solutions. Thank you.…
Q: Select the incorrect reaction. NH2 1. NaNO2, HCI 2. CuCN a CN O b. NO2 NH2 Sn Oc Br H₂N Ph NaBH₂CN…
A: Option a: This option is correct because when an aromatic amine is treated with sodium nitrite and…
Q: None
A: Part 2: Explanation:Step 1: Understand Resonance Forms:Resonance forms are different ways to…
Q: Identify the oxidizing agent and reducing agent combination that would yield the maximum cell…
A: The objective of this question is to identify the combination of oxidizing and reducing agents that…
Q: Use the observations about each chemical reaction in the table below to decide the sign (positive or…
A: Step 1:Reaction A: This reaction is spontaneous only below 23. °C. The spontaneity of a reaction is…
Q: Please don't provide handwritten solution ...
A: Given: 3Cu(aq)2++Cr(OH)3(s)+5OH(aq)−→3Cu(aq)++CrO4(aq)2−+4H2O(l) Step 1: Write the half…
Q: None
A: Step 1:Step 2:Step 3: Hope this helps!
Q: 3216S+10n→?+11H1632S+01n→?+11H Express your answer as a nuclear equation
A: For the given reaction, S atom is bombarded with a neutron.Neutron has no charge and mass number =…
Q: A chemist designs a galvanic cell that uses these two half-reactions: half-reaction Cl₂(9)+2e -…
A: Given: Cl2(g)+2e−→2Cl(aq)−E°red=+1.359VO2(g)+4H(aq)++4e−→2H2O(l)E°red=+1.23VStep 1:…
Q: 1. Predict the major product(s) for the following reactions: ? ? KMnO NaOH, cold HC ? H₂, Pt 1)…
A: (See the last page for the sum up of all the reactions)
Q: 9. Which reagent from the list below reacts with R-2-butanol to form only S-2-bromobutane? (3 pts)…
A: When R-2-butanol reacts with PBr3, it initiates a transformation known as a substitution…
Q: None
A: Step 1:Given compound has a carboxylic acid group (-COOH). Step 2:An amide group (-CONH) is…
Q: Please don't provide handwritten solution ...
A: The objective of this question is to find the partial pressure of Neon (Ne) in a mixture of Helium…
Q: Please don't provide handwritten solution ...
A: Step 1:By Dalton's law of partial pressure "the total pressure of gas mixture is equal to the sum of…
Q: None
A: Benzene ring is common to all the given compounds.numbering/priority order of the substituents is…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- Consider the following flat drawing of methane (CH4) . a. What is HCH bond angle implied by this drawing if you assume it is flat? b. Are the electron domains of this flat CH4 spread out as much as possible? c. Use model materials to make a model of CH4 (methane). If you assembled it correctly, thefour bonds (bonding electron domains) of your model will be 109.5° apart. d. In which representation, the drawing above or the model in your hand (circle one) are theH’s of CH4 more spread out around the central carbon? e. Confirm that your model looks like the following drawing. The wedgebond represents a bond coming out of the page, and the dash bondrepresents a bond going into the page f. You will often see methane drawn as if it were flat (like on the previous page). Why is thismisleading, and what is left to the viewer’s imagination when looking at such a drawing?11) Molecular Geometry/ Electron-Group Geometry Total Valence Formula Rough Lewis Structure Electrons Molecular Geometry: SbCl6 Electron-Group Geo.: (Include formal charges other than 0.) More soluble in Bond Polarity (AEN) Molecule Polarity hexane or water? 12) Molecular Geometry/ Electron-Group Geometry Total Valence Formula Rough Lewis Structure Electrons Molecular Geometry: TeF4 Electron-Group Geo.: (Include formal charges other than 0.) More soluble in Bond Polarity (AEN) Molecule Polarity hexane or water? 10Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2-NC-NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p. To b n d > C > Save for Later 15 4 g 09 h > > > > - k 1 > > > > E n o Р 3 Attempts: 0 of 3 used Submit Answer
- Rank the following series of molecules or ions in order of decreasing bond energy using their bond order to predict relative magnitude: fluorine: F2, oxygen: 02, nitrogen: N2 Rank from highest to lowest bond energy. To rank items as equivalent, overlap them. View Available Hint(s) Reset Help nitrogen fluorine охудen Lowest bond energy Highest bond energy The correct ranking cannot be determined.Consider the ring cation, called "cyclopentadienyl cation".... one of five possible resonance structures that can be drawn for it is shown below. In the actual ring cation, what is the charge on any one carbon atom, and what is the bond order of any one C,C bond? 4? charge on one C = ? bond order of C,C bond ? Select one: O A. +2/5; 4/3 OB. + 1/6; 1.5 O C. + 2/5; 7/5 OD. + 1/5; 6/5 O E. + 1/5; 7/5Calculate the heat of reaction AH for the following reaction: H₂(g) + Cl₂(g) 2 HCl(g) You can find a table of bond energies by using the Data button on the ALEKS toolbar. Round your answer to the nearest kJ/mol. kJ mol al Data [-] Bond energies bond H-H H-F H-CI H-Br H-I H-C H-O H-N H-P H-S bond C-H energy (kJ/mol) 436 570 431 366 298 413 497 391 351 381 energy (kJ/mol) 413 bond O-H O-F O-CI O-Br O-I O-C O=C O=C 0-0 0=0 O-N O=N O=S bond N-H energy (kJ/mol) 497 215 234 210 213 385 532 1077 210 498 206 631 551 energy (kJ/mol) 391 bond F-F F-CI F-Br F-I CI-CI Cl-Br CI-I Br-Br Br-I I-I bond S-H energy (kJ/mol) 159 261 280 272 243 219 211 194 179 152 energy (kJ/mol) 381
- (4e-201) Consider the molecule below. How many total sigma bonds does the compound have? How many total pi bonds? C. H. H. リニ H. C .C. H. HiBonds & Molecules DDraw e in the carbon atom's valence shell below and identify how many bonds car bon con form with otler atoms which is Identify where 6*, 8, coalent bonds t'hydrogen bouds belong in the figure below of tuo wat& (H,0)° Molecules : H H Carbon 6 protons AV H H 3) Identify, rank+ describe the four Key types of bonds in molecules: bond name description Linclude an examele) Strongest ). weakest 4). 4) Label + fill-in the figure below: aka aka A energy (ATP) e aka aka reactions Metabolism =Q1. Draw the Lewis structure of given compound;a) CH3NH2 (metil amine)b) HCOOH (formic acid)c) HCSNH2d) NH2CONH2Q2. Draw Lewis structure of the following species, indication formal charges andresonance where applicable;a) HOSO3-b) H2NCNc) FCO2-d) HCO3-e) FSO3-Q3. Use the VSEPR theory to predict the shape ofa) The molecule OSF2b) The ion ClO3-c) The ion of S2O32-d) Th ion of BrF4