1. What is the mass of a water molecule in grams? 2. A chemist analyzed a sample of a compound that was known to contain potassium, manganese, and oxygen. She obtained the following results: The total mass of the sample = 316.08 g Mass of potassium = 78.20 g Mass of manganese = 109.88 g Determine the percentage composition of the compound 3. If at S.T.P 4.48 L of NH3(g) is allowed to react with 9.03 x 1022 molecules of O₂(g), please answer the questions for the following reaction: 4NH3(g) + 5O₂(g) 6H₂O(g) + 4NO(g) a. What is the limiting reactant? Please show all your work. b. What mass of nitrogen monoxide can be expected? c. If 3.00 g of nitrogen monoxide recovered, what would the percentage yield be? d. What reactant is in excess? Following the reaction, what is the remaining mass of the excess reactant?

1. What is the mass of a water molecule in grams? 2. A chemist analyzed a sample of a compound that was known to contain potassium, manganese, and oxygen. She obtained the following results: The total mass of the sample = 316.08 g Mass of potassium = 78.20 g Mass of manganese = 109.88 g Determine the percentage composition of the compound 3. If at S.T.P 4.48 L of NH3(g) is allowed to react with 9.03 x 1022 molecules of O₂(g), please answer the questions for the following reaction: 4NH3(g) + 5O₂(g) 6H₂O(g) + 4NO(g) a. What is the limiting reactant? Please show all your work. b. What mass of nitrogen monoxide can be expected? c. If 3.00 g of nitrogen monoxide recovered, what would the percentage yield be? d. What reactant is in excess? Following the reaction, what is the remaining mass of the excess reactant?

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter5: Gases

Section: Chapter Questions

Problem 5.108PAE

See similar textbooks

Similar questions

You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
A student prepares phosphorous acid, H3PO3, by reacting solid phosphorus triiodide with water. PI3(s)+3H2O(l)H3PO3(s)+3HI(g) The student needs to obtain 0.250 L of H3PO3(d=1.651g/cm3). The procedure calls for a 45.0% excess of water and a yield of 75.0%. How much phosphorus triiodide should be weighed out? What volume of water (d=1.651g/cm3) should be used?
If 2.33 L of propane at 24°C and 67.2 kPa is completelyburned in excess oxygen, how many moles of carbondioxide will be produced?
If an electric current is passed through molten sodium chloride, elemental chlorine gas is generated as the sodium chloride is decomposed. :math>2NaCl(1)2Na(s)+Cl2(g) at volume of chlorine gas measured at 767 mm Hg at 25 °C would be generated by complete decomposition of 1.25 g of NaCl?
When calcium carbonate is heated strongly, it evolves carbon dioxide gas. CaCO3(s)CaO(s)+CO2(g) 25 g of CaCO3 is heated, what mass of CO2would be produced? What volume would this quantity of CO2 (CU at STP?
A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.
A solution is prepared by diluting 0.7850 L of 1.262 M potassium sulfide solution with water to a final volume of 2.000 L. (a) How many grams of potassium sulfide were dissolved to give the original solution? (b) What are the molarities of the potassium sulfide, potassium ions, and sulfide ions in the diluted solution?